C32H44N6O9 — CID 167494925
(2S)-2-[[(1S)-5-[[(2S)-2-[[4-(aminomethyl)piperidine-1-carbonyl]amino]-3-naphthalen-2-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 167494925) has the molecular formula C32H44N6O9 and a molecular weight of 656.74 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[[(2S)-2-[[4-(aminomethyl)piperidine-1-carbonyl]amino]-3-naphthalen-2-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[[(2S)-2-[[4-(aminomethyl)piperidine-1-carbonyl]amino]-3-naphthalen-2-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 167494925 |
| Molecular Formula | C32H44N6O9 |
| Molecular Weight | 656.74 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | (2S)-2-[[(1S)-5-[[(2S)-2-[[4-(aminomethyl)piperidine-1-carbonyl]amino]-3-naphthalen-2-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | NCC1CCN(C(=O)N[C@@H](Cc2ccc3ccccc3c2)C(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C32H44N6O9/c33-19-20-12-15-38(16-13-20)32(47)37-26(18-21-8-9-22-5-1-2-6-23(22)17-21)28(41)34-14-4-3-7-24(29(42)43)35-31(46)36-25(30(44)45)10-11-27(39)40/h1-2,5-6,8-9,17,20,24-26H,3-4,7,10-16,18-19,33H2,(H,34,41)(H,37,47)(H,39,40)(H,42,43)(H,44,45)(H2,35,36,46)/t24-,25-,26-/m0/s1 |
| InChIKey | KNWZPEHTXPORCM-GSDHBNRESA-N |
| XLogP | 1.49 |
| TPSA | 240.49 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.74 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|