C36H49N5O10S — CID 139447405
(2S)-2-[[1-carboxy-5-[[3-naphthalen-2-yl-2-[[4-[(3-sulfanylpropanoylamino)methyl]cyclohexanecarbonyl]amino]propanoyl]amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 139447405) has the molecular formula C36H49N5O10S and a molecular weight of 743.88 g/mol. Its IUPAC name is (2S)-2-[[1-carboxy-5-[[3-naphthalen-2-yl-2-[[4-[(3-sulfanylpropanoylamino)methyl]cyclohexanecarbonyl]amino]propanoyl]amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[1-carboxy-5-[[3-naphthalen-2-yl-2-[[4-[(3-sulfanylpropanoylamino)methyl]cyclohexanecarbonyl]amino]propanoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 139447405 |
| Molecular Formula | C36H49N5O10S |
| Molecular Weight | 743.88 g/mol |
| Exact Mass | 743.32 |
| IUPAC Name | (2S)-2-[[1-carboxy-5-[[3-naphthalen-2-yl-2-[[4-[(3-sulfanylpropanoylamino)methyl]cyclohexanecarbonyl]amino]propanoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NC(CCCCNC(=O)C(Cc1ccc2ccccc2c1)NC(=O)C1CCC(CNC(=O)CCS)CC1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C36H49N5O10S/c42-30(16-18-52)38-21-22-8-12-25(13-9-22)32(45)39-29(20-23-10-11-24-5-1-2-6-26(24)19-23)33(46)37-17-4-3-7-27(34(47)48)40-36(51)41-28(35(49)50)14-15-31(43)44/h1-2,5-6,10-11,19,22,25,27-29,52H,3-4,7-9,12-18,20-21H2,(H,37,46)(H,38,42)(H,39,45)(H,43,44)(H,47,48)(H,49,50)(H2,40,41,51)/t22?,25?,27?,28-,29?/m0/s1 |
| InChIKey | PBAXVOQYRFXCCP-WYVQKQSCSA-N |
| XLogP | 2.47 |
| TPSA | 240.33 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.88 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|