C49H69GaN9O16 — CID 164793588
CID 164793588 (PubChem CID 164793588) has the molecular formula C49H69GaN9O16 and a molecular weight of 1108.07 g/mol.
| Compound Name | CID 164793588 |
|---|---|
| PubChem CID | 164793588 |
| Molecular Formula | C49H69GaN9O16 |
| Molecular Weight | 1108.07 g/mol |
| Exact Mass | 1107.41 |
| IUPAC Name | — |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)[C@H](Cc1ccc2ccccc2c1)NC(=O)C1CCC(CNC(=O)CN2CCN3CCN(CC(=O)O)CCN(CC2)CC(=O)O[68Ga]OC(=O)C3)CC1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C49H71N9O16.Ga/c59-40(28-55-17-19-56(29-42(62)63)21-23-58(31-44(66)67)24-22-57(20-18-55)30-43(64)65)51-27-32-8-12-35(13-9-32)45(68)52-39(26-33-10-11-34-5-1-2-6-36(34)25-33)46(69)50-16-4-3-7-37(47(70)71)53-49(74)54-38(48(72)73)14-15-41(60)61;/h1-2,5-6,10-11,25,32,35,37-39H,3-4,7-9,12-24,26-31H2,(H,50,69)(H,51,59)(H,52,68)(H,60,61)(H,62,63)(H,64,65)(H,66,67)(H,70,71)(H,72,73)(H2,53,54,74);/q;+2/p-2/t32?,35?,37-,38-,39-;/m0./s1/i;1-2 |
| InChIKey | OIKGKGUBRSZADD-DCZFPAOOSA-L |
| XLogP | -0.91 |
| TPSA | 343.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.07 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|