C32H44N6O9 — CID 167387078
2-[[5-[[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-isoquinolin-7-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 167387078) has the molecular formula C32H44N6O9 and a molecular weight of 656.74 g/mol. Its IUPAC name is 2-[[5-[[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-isoquinolin-7-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[5-[[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-isoquinolin-7-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 167387078 |
| Molecular Formula | C32H44N6O9 |
| Molecular Weight | 656.74 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | 2-[[5-[[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-isoquinolin-7-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | NCC1CCC(C(=O)NC(Cc2ccc3ccncc3c2)C(=O)NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C32H44N6O9/c33-17-19-4-8-22(9-5-19)28(41)36-26(16-20-6-7-21-12-14-34-18-23(21)15-20)29(42)35-13-2-1-3-24(30(43)44)37-32(47)38-25(31(45)46)10-11-27(39)40/h6-7,12,14-15,18-19,22,24-26H,1-5,8-11,13,16-17,33H2,(H,35,42)(H,36,41)(H,39,40)(H,43,44)(H,45,46)(H2,37,38,47) |
| InChIKey | GXRNUZKJNCDFHG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 250.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.74 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|