C29H42N4O3 — CID 58590558
N-[(2R)-1-(5-aminopentylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-(2-ethylbutanoyl)pyrrolidine-2-carboxamide (PubChem CID 58590558) has the molecular formula C29H42N4O3 and a molecular weight of 494.68 g/mol. Its IUPAC name is N-[(2R)-1-(5-aminopentylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-(2-ethylbutanoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[(2R)-1-(5-aminopentylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-(2-ethylbutanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58590558 |
| Molecular Formula | C29H42N4O3 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | N-[(2R)-1-(5-aminopentylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-(2-ethylbutanoyl)pyrrolidine-2-carboxamide |
| SMILES | CCC(CC)C(=O)N1CCCC1C(=O)N[C@H](Cc1ccc2ccccc2c1)C(=O)NCCCCCN |
| InChI | InChI=1S/C29H42N4O3/c1-3-22(4-2)29(36)33-18-10-13-26(33)28(35)32-25(27(34)31-17-9-5-8-16-30)20-21-14-15-23-11-6-7-12-24(23)19-21/h6-7,11-12,14-15,19,22,25-26H,3-5,8-10,13,16-18,20,30H2,1-2H3,(H,31,34)(H,32,35)/t25-,26?/m1/s1 |
| InChIKey | XAZIDNQPZBRTRE-DCWQJPKNSA-N |
| XLogP | 3.54 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|