C35H46N4O3 — CID 21021320
1-(2-ethylbutanoyl)-N-[3-naphthalen-2-yl-1-oxo-1-[3-(2-phenylethylamino)propylamino]propan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 21021320) has the molecular formula C35H46N4O3 and a molecular weight of 570.78 g/mol. Its IUPAC name is 1-(2-ethylbutanoyl)-N-[3-naphthalen-2-yl-1-oxo-1-[3-(2-phenylethylamino)propylamino]propan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-ethylbutanoyl)-N-[3-naphthalen-2-yl-1-oxo-1-[3-(2-phenylethylamino)propylamino]propan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 21021320 |
| Molecular Formula | C35H46N4O3 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | 1-(2-ethylbutanoyl)-N-[3-naphthalen-2-yl-1-oxo-1-[3-(2-phenylethylamino)propylamino]propan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CCC(CC)C(=O)N1CCCC1C(=O)NC(Cc1ccc2ccccc2c1)C(=O)NCCCNCCc1ccccc1 |
| InChI | InChI=1S/C35H46N4O3/c1-3-28(4-2)35(42)39-23-10-16-32(39)34(41)38-31(25-27-17-18-29-14-8-9-15-30(29)24-27)33(40)37-21-11-20-36-22-19-26-12-6-5-7-13-26/h5-9,12-15,17-18,24,28,31-32,36H,3-4,10-11,16,19-23,25H2,1-2H3,(H,37,40)(H,38,41) |
| InChIKey | NQTVCWGWUUCZQI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|