C31H45ClN4O3 — CID 157131711
1-(cyclopentanecarbonyl)-N-[(2R)-1-[3-(2-methylpropylamino)propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 157131711) has the molecular formula C31H45ClN4O3 and a molecular weight of 557.18 g/mol. Its IUPAC name is 1-(cyclopentanecarbonyl)-N-[(2R)-1-[3-(2-methylpropylamino)propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | 1-(cyclopentanecarbonyl)-N-[(2R)-1-[3-(2-methylpropylamino)propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 157131711 |
| Molecular Formula | C31H45ClN4O3 |
| Molecular Weight | 557.18 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | 1-(cyclopentanecarbonyl)-N-[(2R)-1-[3-(2-methylpropylamino)propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CC(C)CNCCCNC(=O)[C@@H](Cc1ccc2ccccc2c1)NC(=O)C1CCCN1C(=O)C1CCCC1.Cl |
| InChI | InChI=1S/C31H44N4O3.ClH/c1-22(2)21-32-16-8-17-33-29(36)27(20-23-14-15-24-9-3-6-12-26(24)19-23)34-30(37)28-13-7-18-35(28)31(38)25-10-4-5-11-25;/h3,6,9,12,14-15,19,22,25,27-28,32H,4-5,7-8,10-11,13,16-18,20-21H2,1-2H3,(H,33,36)(H,34,37);1H/t27-,28?;/m1./s1 |
| InChIKey | FZCDTEFCNPCEOE-RTJZFNRYSA-N |
| XLogP | 4.22 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|