C36H50N4O4 — CID 21021403
N-[1-[3-(furan-2-ylmethylamino)propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-[4-methyl-2-(2-methylpropyl)pentanoyl]pyrrolidine-2-carboxamide (PubChem CID 21021403) has the molecular formula C36H50N4O4 and a molecular weight of 602.82 g/mol. Its IUPAC name is N-[1-[3-(furan-2-ylmethylamino)propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-[4-methyl-2-(2-methylpropyl)pentanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[1-[3-(furan-2-ylmethylamino)propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-[4-methyl-2-(2-methylpropyl)pentanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 21021403 |
| Molecular Formula | C36H50N4O4 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.38 |
| IUPAC Name | N-[1-[3-(furan-2-ylmethylamino)propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-[4-methyl-2-(2-methylpropyl)pentanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)CC(CC(C)C)C(=O)N1CCCC1C(=O)NC(Cc1ccc2ccccc2c1)C(=O)NCCCNCc1ccco1 |
| InChI | InChI=1S/C36H50N4O4/c1-25(2)20-30(21-26(3)4)36(43)40-18-7-13-33(40)35(42)39-32(23-27-14-15-28-10-5-6-11-29(28)22-27)34(41)38-17-9-16-37-24-31-12-8-19-44-31/h5-6,8,10-12,14-15,19,22,25-26,30,32-33,37H,7,9,13,16-18,20-21,23-24H2,1-4H3,(H,38,41)(H,39,42) |
| InChIKey | VPTJXOVAPYRCOV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|