C40H43N5O3 — CID 16738359
(2S)-6-amino-N-benzyl-2-[(4R)-4-(3,3-diphenylpropanoylamino)-3-oxo-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]hexanamide (PubChem CID 16738359) has the molecular formula C40H43N5O3 and a molecular weight of 641.82 g/mol. Its IUPAC name is (2S)-6-amino-N-benzyl-2-[(4R)-4-(3,3-diphenylpropanoylamino)-3-oxo-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]hexanamide.
| Compound Name | (2S)-6-amino-N-benzyl-2-[(4R)-4-(3,3-diphenylpropanoylamino)-3-oxo-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]hexanamide |
|---|---|
| PubChem CID | 16738359 |
| Molecular Formula | C40H43N5O3 |
| Molecular Weight | 641.82 g/mol |
| Exact Mass | 641.34 |
| IUPAC Name | (2S)-6-amino-N-benzyl-2-[(4R)-4-(3,3-diphenylpropanoylamino)-3-oxo-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]hexanamide |
| SMILES | NCCCC[C@@H](C(=O)NCc1ccccc1)N1Cc2[nH]c3ccccc3c2C[C@@H](NC(=O)CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C40H43N5O3/c41-23-13-12-22-37(39(47)42-26-28-14-4-1-5-15-28)45-27-36-33(31-20-10-11-21-34(31)43-36)24-35(40(45)48)44-38(46)25-32(29-16-6-2-7-17-29)30-18-8-3-9-19-30/h1-11,14-21,32,35,37,43H,12-13,22-27,41H2,(H,42,47)(H,44,46)/t35-,37+/m1/s1 |
| InChIKey | HBLIGSJPLIFUFI-BZFILIQBSA-N |
| XLogP | 5.57 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.82 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|