C22H27N3O2 — CID 59757318
(2R)-2-[(3S)-3-amino-2-oxoazepan-1-yl]-N-benzyl-3-phenylpropanamide (PubChem CID 59757318) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (2R)-2-[(3S)-3-amino-2-oxoazepan-1-yl]-N-benzyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3S)-3-amino-2-oxoazepan-1-yl]-N-benzyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 59757318 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (2R)-2-[(3S)-3-amino-2-oxoazepan-1-yl]-N-benzyl-3-phenylpropanamide |
| SMILES | N[C@H]1CCCCN([C@H](Cc2ccccc2)C(=O)NCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H27N3O2/c23-19-13-7-8-14-25(22(19)27)20(15-17-9-3-1-4-10-17)21(26)24-16-18-11-5-2-6-12-18/h1-6,9-12,19-20H,7-8,13-16,23H2,(H,24,26)/t19-,20+/m0/s1 |
| InChIKey | BNLMWMIUMRZRIO-VQTJNVASSA-N |
| XLogP | 2.25 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |