C35H38F3N5O5 — CID 25188775
(2R)-6-amino-N-benzyl-2-[(4R)-3-oxo-4-[(2-phenylacetyl)amino]-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]hexanamide;2,2,2-trifluoroacetic acid (PubChem CID 25188775) has the molecular formula C35H38F3N5O5 and a molecular weight of 665.71 g/mol. Its IUPAC name is (2R)-6-amino-N-benzyl-2-[(4R)-3-oxo-4-[(2-phenylacetyl)amino]-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]hexanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-6-amino-N-benzyl-2-[(4R)-3-oxo-4-[(2-phenylacetyl)amino]-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]hexanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 25188775 |
| Molecular Formula | C35H38F3N5O5 |
| Molecular Weight | 665.71 g/mol |
| Exact Mass | 665.28 |
| IUPAC Name | (2R)-6-amino-N-benzyl-2-[(4R)-3-oxo-4-[(2-phenylacetyl)amino]-1,4,5,10-tetrahydroazepino[3,4-b]indol-2-yl]hexanamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCCC[C@H](C(=O)NCc1ccccc1)N1Cc2[nH]c3ccccc3c2C[C@@H](NC(=O)Cc2ccccc2)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C33H37N5O3.C2HF3O2/c34-18-10-9-17-30(32(40)35-21-24-13-5-2-6-14-24)38-22-29-26(25-15-7-8-16-27(25)36-29)20-28(33(38)41)37-31(39)19-23-11-3-1-4-12-23;3-2(4,5)1(6)7/h1-8,11-16,28,30,36H,9-10,17-22,34H2,(H,35,40)(H,37,39);(H,6,7)/t28-,30-;/m1./s1 |
| InChIKey | AUTAZSRNKRMUDE-XDSAXFAGSA-N |
| XLogP | 4.23 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|