C30H40N4O2 — CID 54369884
(3R)-2-N-(3-methylphenyl)-3-N,3-N-dipentyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2,3-dicarboxamide (PubChem CID 54369884) has the molecular formula C30H40N4O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is (3R)-2-N-(3-methylphenyl)-3-N,3-N-dipentyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2,3-dicarboxamide.
| Compound Name | (3R)-2-N-(3-methylphenyl)-3-N,3-N-dipentyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2,3-dicarboxamide |
|---|---|
| PubChem CID | 54369884 |
| Molecular Formula | C30H40N4O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | (3R)-2-N-(3-methylphenyl)-3-N,3-N-dipentyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2,3-dicarboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)[C@H]1Cc2c([nH]c3ccccc23)CN1C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C30H40N4O2/c1-4-6-10-17-33(18-11-7-5-2)29(35)28-20-25-24-15-8-9-16-26(24)32-27(25)21-34(28)30(36)31-23-14-12-13-22(3)19-23/h8-9,12-16,19,28,32H,4-7,10-11,17-18,20-21H2,1-3H3,(H,31,36)/t28-/m1/s1 |
| InChIKey | USKLRDUYTOPAGM-MUUNZHRXSA-N |
| XLogP | 6.64 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|