C25H34N2O2 — CID 2827356
1-N-(3-methylphenyl)-2-N,2-N-dipentylbenzene-1,2-dicarboxamide (PubChem CID 2827356) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-N-(3-methylphenyl)-2-N,2-N-dipentylbenzene-1,2-dicarboxamide.
| Compound Name | 1-N-(3-methylphenyl)-2-N,2-N-dipentylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 2827356 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 1-N-(3-methylphenyl)-2-N,2-N-dipentylbenzene-1,2-dicarboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)c1ccccc1C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C25H34N2O2/c1-4-6-10-17-27(18-11-7-5-2)25(29)23-16-9-8-15-22(23)24(28)26-21-14-12-13-20(3)19-21/h8-9,12-16,19H,4-7,10-11,17-18H2,1-3H3,(H,26,28) |
| InChIKey | NTTTYIQZEJEBOM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|