C28H34N2O2 — CID 2827367
1-N-naphthalen-1-yl-2-N,2-N-dipentylbenzene-1,2-dicarboxamide (PubChem CID 2827367) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 1-N-naphthalen-1-yl-2-N,2-N-dipentylbenzene-1,2-dicarboxamide.
| Compound Name | 1-N-naphthalen-1-yl-2-N,2-N-dipentylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 2827367 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 1-N-naphthalen-1-yl-2-N,2-N-dipentylbenzene-1,2-dicarboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)c1ccccc1C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C28H34N2O2/c1-3-5-11-20-30(21-12-6-4-2)28(32)25-18-10-9-17-24(25)27(31)29-26-19-13-15-22-14-7-8-16-23(22)26/h7-10,13-19H,3-6,11-12,20-21H2,1-2H3,(H,29,31) |
| InChIKey | KMHUVHFOXFAQMY-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|