C19H25N3O2 — CID 130265571
N-acetyl-N-butyl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 130265571) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-acetyl-N-butyl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-acetyl-N-butyl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 130265571 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N-acetyl-N-butyl-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | CCCCN(C(C)=O)C(=O)N1Cc2[nH]c3ccccc3c2CC1C |
| InChI | InChI=1S/C19H25N3O2/c1-4-5-10-21(14(3)23)19(24)22-12-18-16(11-13(22)2)15-8-6-7-9-17(15)20-18/h6-9,13,20H,4-5,10-12H2,1-3H3 |
| InChIKey | JEGQOIPBSHZRBH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|