C23H25N3O4 — CID 142191154
1,3-benzodioxole;N-methyl-N-[2-[(3R)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]formamide (PubChem CID 142191154) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1,3-benzodioxole;N-methyl-N-[2-[(3R)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]formamide.
| Compound Name | 1,3-benzodioxole;N-methyl-N-[2-[(3R)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]formamide |
|---|---|
| PubChem CID | 142191154 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1,3-benzodioxole;N-methyl-N-[2-[(3R)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]formamide |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)CN1C(=O)CN(C)C=O.c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H19N3O2.C7H6O2/c1-11-7-13-12-5-3-4-6-14(12)17-15(13)8-19(11)16(21)9-18(2)10-20;1-2-4-7-6(3-1)8-5-9-7/h3-6,10-11,17H,7-9H2,1-2H3;1-4H,5H2/t11-;/m1./s1 |
| InChIKey | GVAVHKVFZDFODV-RFVHGSKJSA-N |
| XLogP | 2.94 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|