C13H12N2O4 — CID 175928782
4,4-dideuterio-3,9-dihydro-1H-pyrido[3,4-b]indole-2,3-dicarboxylic acid (PubChem CID 175928782) has the molecular formula C13H12N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 4,4-dideuterio-3,9-dihydro-1H-pyrido[3,4-b]indole-2,3-dicarboxylic acid.
| Compound Name | 4,4-dideuterio-3,9-dihydro-1H-pyrido[3,4-b]indole-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175928782 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4,4-dideuterio-3,9-dihydro-1H-pyrido[3,4-b]indole-2,3-dicarboxylic acid |
| SMILES | [2H]C1([2H])c2c([nH]c3ccccc23)CN(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C13H12N2O4/c16-12(17)11-5-8-7-3-1-2-4-9(7)14-10(8)6-15(11)13(18)19/h1-4,11,14H,5-6H2,(H,16,17)(H,18,19)/i5D2 |
| InChIKey | WQUCNRVEMCJEFR-BFWBPSQCSA-N |
| XLogP | 1.66 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|