C15H16N2O2 — CID 97297670
(2S,3aR)-2,3,3a,4,9,10-hexahydro-1H-indolizino[6,7-b]indole-2-carboxylic acid (PubChem CID 97297670) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is (2S,3aR)-2,3,3a,4,9,10-hexahydro-1H-indolizino[6,7-b]indole-2-carboxylic acid.
| Compound Name | (2S,3aR)-2,3,3a,4,9,10-hexahydro-1H-indolizino[6,7-b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 97297670 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (2S,3aR)-2,3,3a,4,9,10-hexahydro-1H-indolizino[6,7-b]indole-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H]2Cc3c([nH]c4ccccc34)CN2C1 |
| InChI | InChI=1S/C15H16N2O2/c18-15(19)9-5-10-6-12-11-3-1-2-4-13(11)16-14(12)8-17(10)7-9/h1-4,9-10,16H,5-8H2,(H,18,19)/t9-,10+/m0/s1 |
| InChIKey | ADJRVNADGMXMCZ-VHSXEESVSA-N |
| XLogP | 2.00 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|