C20H21N3 — CID 129386314
(8S)-6-phenyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene (PubChem CID 129386314) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is (8S)-6-phenyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene.
| Compound Name | (8S)-6-phenyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene |
|---|---|
| PubChem CID | 129386314 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | (8S)-6-phenyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene |
| SMILES | c1ccc(N2CCN3Cc4[nH]c5ccccc5c4C[C@H]3C2)cc1 |
| InChI | InChI=1S/C20H21N3/c1-2-6-15(7-3-1)22-10-11-23-14-20-18(12-16(23)13-22)17-8-4-5-9-19(17)21-20/h1-9,16,21H,10-14H2/t16-/m0/s1 |
| InChIKey | BKUAQVITXKPPJO-INIZCTEOSA-N |
| XLogP | 3.41 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|