C25H31N3 — CID 10292753
N,N-dimethyl-1-phenyl-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)cyclohexan-1-amine (PubChem CID 10292753) has the molecular formula C25H31N3 and a molecular weight of 373.54 g/mol. Its IUPAC name is N,N-dimethyl-1-phenyl-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)cyclohexan-1-amine.
| Compound Name | N,N-dimethyl-1-phenyl-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 10292753 |
| Molecular Formula | C25H31N3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | N,N-dimethyl-1-phenyl-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)cyclohexan-1-amine |
| SMILES | CN(C)C1(c2ccccc2)CCC(N2CCc3c([nH]c4ccccc34)C2)CC1 |
| InChI | InChI=1S/C25H31N3/c1-27(2)25(19-8-4-3-5-9-19)15-12-20(13-16-25)28-17-14-22-21-10-6-7-11-23(21)26-24(22)18-28/h3-11,20,26H,12-18H2,1-2H3 |
| InChIKey | YRWHVSGOTAHSKV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|