C25H33ClN2O — CID 24953997
3-[2-[4-(dimethylamino)-4-phenylcyclohexyl]-1H-indol-3-yl]propan-1-ol;hydrochloride (PubChem CID 24953997) has the molecular formula C25H33ClN2O and a molecular weight of 413.01 g/mol. Its IUPAC name is 3-[2-[4-(dimethylamino)-4-phenylcyclohexyl]-1H-indol-3-yl]propan-1-ol;hydrochloride.
| Compound Name | 3-[2-[4-(dimethylamino)-4-phenylcyclohexyl]-1H-indol-3-yl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 24953997 |
| Molecular Formula | C25H33ClN2O |
| Molecular Weight | 413.01 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 3-[2-[4-(dimethylamino)-4-phenylcyclohexyl]-1H-indol-3-yl]propan-1-ol;hydrochloride |
| SMILES | CN(C)C1(c2ccccc2)CCC(c2[nH]c3ccccc3c2CCCO)CC1.Cl |
| InChI | InChI=1S/C25H32N2O.ClH/c1-27(2)25(20-9-4-3-5-10-20)16-14-19(15-17-25)24-22(12-8-18-28)21-11-6-7-13-23(21)26-24;/h3-7,9-11,13,19,26,28H,8,12,14-18H2,1-2H3;1H |
| InChIKey | CXYJTBUFPUTNLM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.01 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |