C14H17N3 — CID 102084649
(8S)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene (PubChem CID 102084649) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is (8S)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene.
| Compound Name | (8S)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene |
|---|---|
| PubChem CID | 102084649 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | (8S)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene |
| SMILES | c1ccc2c3c([nH]c2c1)CN1CCNC[C@@H]1C3 |
| InChI | InChI=1S/C14H17N3/c1-2-4-13-11(3-1)12-7-10-8-15-5-6-17(10)9-14(12)16-13/h1-4,10,15-16H,5-9H2/t10-/m0/s1 |
| InChIKey | FLWHGQJRIYDGPK-JTQLQIEISA-N |
| XLogP | 1.50 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|