C22H25N3 — CID 73057583
(9S)-7-benzyl-3,7,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene (PubChem CID 73057583) has the molecular formula C22H25N3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (9S)-7-benzyl-3,7,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene.
| Compound Name | (9S)-7-benzyl-3,7,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene |
|---|---|
| PubChem CID | 73057583 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (9S)-7-benzyl-3,7,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene |
| SMILES | c1ccc(CN2CCCN3Cc4[nH]c5ccccc5c4C[C@H]3C2)cc1 |
| InChI | InChI=1S/C22H25N3/c1-2-7-17(8-3-1)14-24-11-6-12-25-16-22-20(13-18(25)15-24)19-9-4-5-10-21(19)23-22/h1-5,7-10,18,23H,6,11-16H2/t18-/m0/s1 |
| InChIKey | QJJORQCENSMRQM-SFHVURJKSA-N |
| XLogP | 3.80 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|