C28H29N3 — CID 73057588
(8R,9S)-7-benzyl-8-phenyl-3,7,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene (PubChem CID 73057588) has the molecular formula C28H29N3 and a molecular weight of 407.56 g/mol. Its IUPAC name is (8R,9S)-7-benzyl-8-phenyl-3,7,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene.
| Compound Name | (8R,9S)-7-benzyl-8-phenyl-3,7,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene |
|---|---|
| PubChem CID | 73057588 |
| Molecular Formula | C28H29N3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | (8R,9S)-7-benzyl-8-phenyl-3,7,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene |
| SMILES | c1ccc(CN2CCCN3Cc4[nH]c5ccccc5c4C[C@H]3[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29N3/c1-3-10-21(11-4-1)19-31-17-9-16-30-20-26-24(23-14-7-8-15-25(23)29-26)18-27(30)28(31)22-12-5-2-6-13-22/h1-8,10-15,27-29H,9,16-20H2/t27-,28+/m0/s1 |
| InChIKey | NARAVHHWPKQCIX-WUFINQPMSA-N |
| XLogP | 5.54 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|