C24H20N2O — CID 101226923
2-benzyl-3-phenyl-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one (PubChem CID 101226923) has the molecular formula C24H20N2O and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-benzyl-3-phenyl-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one.
| Compound Name | 2-benzyl-3-phenyl-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one |
|---|---|
| PubChem CID | 101226923 |
| Molecular Formula | C24H20N2O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-benzyl-3-phenyl-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one |
| SMILES | O=c1c2c([nH]c3ccccc13)C(c1ccccc1)N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H20N2O/c27-24-19-13-7-8-14-21(19)25-22-20(24)16-26(15-17-9-3-1-4-10-17)23(22)18-11-5-2-6-12-18/h1-14,23H,15-16H2,(H,25,27) |
| InChIKey | YRBJJOOSIFBXSA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |