C26H23N3O — CID 71070464
13-benzyl-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one (PubChem CID 71070464) has the molecular formula C26H23N3O and a molecular weight of 393.49 g/mol. Its IUPAC name is 13-benzyl-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one.
| Compound Name | 13-benzyl-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one |
|---|---|
| PubChem CID | 71070464 |
| Molecular Formula | C26H23N3O |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 13-benzyl-10-phenyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one |
| SMILES | O=C1N(Cc2ccccc2)CC2Cc3c([nH]c4ccccc34)C(c3ccccc3)N12 |
| InChI | InChI=1S/C26H23N3O/c30-26-28(16-18-9-3-1-4-10-18)17-20-15-22-21-13-7-8-14-23(21)27-24(22)25(29(20)26)19-11-5-2-6-12-19/h1-14,20,25,27H,15-17H2 |
| InChIKey | WFZHJQWHKFWYKA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|