C15H23N3 — CID 82384775
2-benzyl-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-8-amine (PubChem CID 82384775) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-benzyl-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-8-amine.
| Compound Name | 2-benzyl-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-8-amine |
|---|---|
| PubChem CID | 82384775 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 2-benzyl-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-8-amine |
| SMILES | NC1CC2CN(Cc3ccccc3)CCCN2C1 |
| InChI | InChI=1S/C15H23N3/c16-14-9-15-12-17(7-4-8-18(15)11-14)10-13-5-2-1-3-6-13/h1-3,5-6,14-15H,4,7-12,16H2 |
| InChIKey | WYVNLQCKNXJNTH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |