C18H29N3 — CID 130751645
3-(4-benzyl-6-methyl-1,4-diazepan-1-yl)cyclopentan-1-amine (PubChem CID 130751645) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 3-(4-benzyl-6-methyl-1,4-diazepan-1-yl)cyclopentan-1-amine.
| Compound Name | 3-(4-benzyl-6-methyl-1,4-diazepan-1-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 130751645 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 3-(4-benzyl-6-methyl-1,4-diazepan-1-yl)cyclopentan-1-amine |
| SMILES | CC1CN(Cc2ccccc2)CCN(C2CCC(N)C2)C1 |
| InChI | InChI=1S/C18H29N3/c1-15-12-20(14-16-5-3-2-4-6-16)9-10-21(13-15)18-8-7-17(19)11-18/h2-6,15,17-18H,7-14,19H2,1H3 |
| InChIKey | ZDWKBTQGLYCHOI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |