C18H28N2 — CID 784492
1-benzyl-4-[(1R,3S)-3-methylcyclohexyl]piperazine (PubChem CID 784492) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-benzyl-4-[(1R,3S)-3-methylcyclohexyl]piperazine.
| Compound Name | 1-benzyl-4-[(1R,3S)-3-methylcyclohexyl]piperazine |
|---|---|
| PubChem CID | 784492 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-benzyl-4-[(1R,3S)-3-methylcyclohexyl]piperazine |
| SMILES | C[C@H]1CCC[C@@H](N2CCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C18H28N2/c1-16-6-5-9-18(14-16)20-12-10-19(11-13-20)15-17-7-3-2-4-8-17/h2-4,7-8,16,18H,5-6,9-15H2,1H3/t16-,18+/m0/s1 |
| InChIKey | NSCVTMGYYPFBSJ-FUHWJXTLSA-N |
| XLogP | 3.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |