C18H27ClN2 — CID 7108986
1-[(3-chlorophenyl)methyl]-4-[(1S,3S)-3-methylcyclohexyl]piperazine (PubChem CID 7108986) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-[(1S,3S)-3-methylcyclohexyl]piperazine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-[(1S,3S)-3-methylcyclohexyl]piperazine |
|---|---|
| PubChem CID | 7108986 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-[(1S,3S)-3-methylcyclohexyl]piperazine |
| SMILES | C[C@H]1CCC[C@H](N2CCN(Cc3cccc(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C18H27ClN2/c1-15-4-2-7-18(12-15)21-10-8-20(9-11-21)14-16-5-3-6-17(19)13-16/h3,5-6,13,15,18H,2,4,7-12,14H2,1H3/t15-,18-/m0/s1 |
| InChIKey | NIRUOPOIPAZYMS-YJBOKZPZSA-N |
| XLogP | 4.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |