C18H27BrN2 — CID 1360754
1-[(2-bromophenyl)methyl]-4-[(1R,3S)-3-methylcyclohexyl]piperazine (PubChem CID 1360754) has the molecular formula C18H27BrN2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-4-[(1R,3S)-3-methylcyclohexyl]piperazine.
| Compound Name | 1-[(2-bromophenyl)methyl]-4-[(1R,3S)-3-methylcyclohexyl]piperazine |
|---|---|
| PubChem CID | 1360754 |
| Molecular Formula | C18H27BrN2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-4-[(1R,3S)-3-methylcyclohexyl]piperazine |
| SMILES | C[C@H]1CCC[C@@H](N2CCN(Cc3ccccc3Br)CC2)C1 |
| InChI | InChI=1S/C18H27BrN2/c1-15-5-4-7-17(13-15)21-11-9-20(10-12-21)14-16-6-2-3-8-18(16)19/h2-3,6,8,15,17H,4-5,7,9-14H2,1H3/t15-,17+/m0/s1 |
| InChIKey | YKBXEVRDBOQIHE-DOTOQJQBSA-N |
| XLogP | 4.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |