C19H30N2O — CID 786304
1-[(3-methoxyphenyl)methyl]-4-[(1S,3S)-3-methylcyclohexyl]piperazine (PubChem CID 786304) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-4-[(1S,3S)-3-methylcyclohexyl]piperazine.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-4-[(1S,3S)-3-methylcyclohexyl]piperazine |
|---|---|
| PubChem CID | 786304 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-4-[(1S,3S)-3-methylcyclohexyl]piperazine |
| SMILES | COc1cccc(CN2CCN([C@H]3CCC[C@H](C)C3)CC2)c1 |
| InChI | InChI=1S/C19H30N2O/c1-16-5-3-7-18(13-16)21-11-9-20(10-12-21)15-17-6-4-8-19(14-17)22-2/h4,6,8,14,16,18H,3,5,7,9-13,15H2,1-2H3/t16-,18-/m0/s1 |
| InChIKey | UUVVFTHEEURCEN-WMZOPIPTSA-N |
| XLogP | 3.39 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |