C22H34N2O6 — CID 90483881
1-[(3,4-dimethoxyphenyl)methyl]-4-(3-methylcyclohexyl)piperazine;oxalic acid (PubChem CID 90483881) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-4-(3-methylcyclohexyl)piperazine;oxalic acid.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-(3-methylcyclohexyl)piperazine;oxalic acid |
|---|---|
| PubChem CID | 90483881 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-(3-methylcyclohexyl)piperazine;oxalic acid |
| SMILES | COc1ccc(CN2CCN(C3CCCC(C)C3)CC2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H32N2O2.C2H2O4/c1-16-5-4-6-18(13-16)22-11-9-21(10-12-22)15-17-7-8-19(23-2)20(14-17)24-3;3-1(4)2(5)6/h7-8,14,16,18H,4-6,9-13,15H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | JCBOACDKMTYTCJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|