C14H24ClNO — CID 145435843
1-[(3-chlorophenyl)methyl]pyrrolidine;ethane;methanol (PubChem CID 145435843) has the molecular formula C14H24ClNO and a molecular weight of 257.81 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]pyrrolidine;ethane;methanol.
| Compound Name | 1-[(3-chlorophenyl)methyl]pyrrolidine;ethane;methanol |
|---|---|
| PubChem CID | 145435843 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.81 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]pyrrolidine;ethane;methanol |
| SMILES | CC.CO.Clc1cccc(CN2CCCC2)c1 |
| InChI | InChI=1S/C11H14ClN.C2H6.CH4O/c12-11-5-3-4-10(8-11)9-13-6-1-2-7-13;2*1-2/h3-5,8H,1-2,6-7,9H2;1-2H3;2H,1H3 |
| InChIKey | JGTAVWRZCVUYHZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.81 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |