C22H23N3O5 — CID 70157358
3-[(6-carboxy-6-ethylcyclohexa-2,4-dien-1-yl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylic acid (PubChem CID 70157358) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 3-[(6-carboxy-6-ethylcyclohexa-2,4-dien-1-yl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylic acid.
| Compound Name | 3-[(6-carboxy-6-ethylcyclohexa-2,4-dien-1-yl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 70157358 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-[(6-carboxy-6-ethylcyclohexa-2,4-dien-1-yl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylic acid |
| SMILES | CCC1(C(=O)O)C=CC=CC1NC(=O)C1Cc2c([nH]c3ccccc23)CN1C(=O)O |
| InChI | InChI=1S/C22H23N3O5/c1-2-22(20(27)28)10-6-5-9-18(22)24-19(26)17-11-14-13-7-3-4-8-15(13)23-16(14)12-25(17)21(29)30/h3-10,17-18,23H,2,11-12H2,1H3,(H,24,26)(H,27,28)(H,29,30) |
| InChIKey | LRWCLJUZQMCTHN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|