C13H10N2Na2O2S2 — CID 88644242
disodium;2-sulfidocarbothioyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 88644242) has the molecular formula C13H10N2Na2O2S2 and a molecular weight of 336.35 g/mol. Its IUPAC name is disodium;2-sulfidocarbothioyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | disodium;2-sulfidocarbothioyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 88644242 |
| Molecular Formula | C13H10N2Na2O2S2 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | disodium;2-sulfidocarbothioyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | O=C([O-])C1Cc2c([nH]c3ccccc23)CN1C(=S)[S-].[Na+].[Na+] |
| InChI | InChI=1S/C13H12N2O2S2.2Na/c16-12(17)11-5-8-7-3-1-2-4-9(7)14-10(8)6-15(11)13(18)19;;/h1-4,11,14H,5-6H2,(H,16,17)(H,18,19);;/q;2*+1/p-2 |
| InChIKey | XZFZTCFJUQHOOD-UHFFFAOYSA-L |
| XLogP | -5.52 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|