C11H10N2 — CID 68923227
2,5-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 68923227) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 2,5-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 2,5-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 68923227 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2,5-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | C1=Cc2[nH]c3ccccc3c2CN1 |
| InChI | InChI=1S/C11H10N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-6,12-13H,7H2 |
| InChIKey | SHTPHYSDMOPHFK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |