C10H12N3P — CID 146492364
1,2,3,4,5,10-hexahydro-[1,2,4]diazaphosphepino[5,6-b]indole (PubChem CID 146492364) has the molecular formula C10H12N3P and a molecular weight of 205.20 g/mol. Its IUPAC name is 1,2,3,4,5,10-hexahydro-[1,2,4]diazaphosphepino[5,6-b]indole.
| Compound Name | 1,2,3,4,5,10-hexahydro-[1,2,4]diazaphosphepino[5,6-b]indole |
|---|---|
| PubChem CID | 146492364 |
| Molecular Formula | C10H12N3P |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 1,2,3,4,5,10-hexahydro-[1,2,4]diazaphosphepino[5,6-b]indole |
| SMILES | c1ccc2c3c([nH]c2c1)PCNNC3 |
| InChI | InChI=1S/C10H12N3P/c1-2-4-9-7(3-1)8-5-11-12-6-14-10(8)13-9/h1-4,11-14H,5-6H2 |
| InChIKey | AXCOJFONORYKLB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|