C12H12N2O — CID 84581981
N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)formamide (PubChem CID 84581981) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)formamide.
| Compound Name | N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)formamide |
|---|---|
| PubChem CID | 84581981 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)formamide |
| SMILES | O=CNC1Cc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C12H12N2O/c15-7-13-8-5-10-9-3-1-2-4-11(9)14-12(10)6-8/h1-4,7-8,14H,5-6H2,(H,13,15) |
| InChIKey | XYNMQXQATPIVIJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|