C20H20N2O3 — CID 84580618
3,4-dimethoxy-N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)benzamide (PubChem CID 84580618) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)benzamide |
|---|---|
| PubChem CID | 84580618 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3,4-dimethoxy-N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)benzamide |
| SMILES | COc1ccc(C(=O)NC2Cc3[nH]c4ccccc4c3C2)cc1OC |
| InChI | InChI=1S/C20H20N2O3/c1-24-18-8-7-12(9-19(18)25-2)20(23)21-13-10-15-14-5-3-4-6-16(14)22-17(15)11-13/h3-9,13,22H,10-11H2,1-2H3,(H,21,23) |
| InChIKey | FEHASMKMNKFUFJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|