C15H20N2O5 — CID 141160918
(3S,5R)-5-[(3,4-dimethoxybenzoyl)amino]piperidine-3-carboxylic acid (PubChem CID 141160918) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is (3S,5R)-5-[(3,4-dimethoxybenzoyl)amino]piperidine-3-carboxylic acid.
| Compound Name | (3S,5R)-5-[(3,4-dimethoxybenzoyl)amino]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 141160918 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (3S,5R)-5-[(3,4-dimethoxybenzoyl)amino]piperidine-3-carboxylic acid |
| SMILES | COc1ccc(C(=O)N[C@H]2CNC[C@@H](C(=O)O)C2)cc1OC |
| InChI | InChI=1S/C15H20N2O5/c1-21-12-4-3-9(6-13(12)22-2)14(18)17-11-5-10(15(19)20)7-16-8-11/h3-4,6,10-11,16H,5,7-8H2,1-2H3,(H,17,18)(H,19,20)/t10-,11+/m0/s1 |
| InChIKey | PIJRANBIVNDWSE-WDEREUQCSA-N |
| XLogP | 0.50 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |