C16H22N2O5 — CID 94778325
1-[[(3,4-dimethoxybenzoyl)amino]methyl]piperidine-4-carboxylic acid (PubChem CID 94778325) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 1-[[(3,4-dimethoxybenzoyl)amino]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[(3,4-dimethoxybenzoyl)amino]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 94778325 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-[[(3,4-dimethoxybenzoyl)amino]methyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc(C(=O)NCN2CCC(C(=O)O)CC2)cc1OC |
| InChI | InChI=1S/C16H22N2O5/c1-22-13-4-3-12(9-14(13)23-2)15(19)17-10-18-7-5-11(6-8-18)16(20)21/h3-4,9,11H,5-8,10H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | VXLRHMNZCUXAFP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |