About 3,6-ditert-butyl-4,9-dihydro-3H-carbazole
3,6-ditert-butyl-4,9-dihydro-3H-carbazole (PubChem CID 70986017) has the molecular formula C20H27N
and a molecular weight of 281.44 g/mol. Its IUPAC name is 3,6-ditert-butyl-4,9-dihydro-3H-carbazole.
Molecular Properties
| Compound Name | 3,6-ditert-butyl-4,9-dihydro-3H-carbazole |
| PubChem CID | 70986017 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 3,6-ditert-butyl-4,9-dihydro-3H-carbazole |
| SMILES | CC(C)(C)c1ccc2[nH]c3c(c2c1)CC(C(C)(C)C)C=C3 |
| InChI | InChI=1S/C20H27N/c1-19(2,3)13-7-9-17-15(11-13)16-12-14(20(4,5)6)8-10-18(16)21-17/h7-11,14,21H,12H2,1-6H3 |
| InChIKey | JYFYTCBLMPJSQJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,6-ditert-butyl-4,9-dihydro-3H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-ditert-butyl-4,9-dihydro-3H-carbazole?
The IUPAC name of 3,6-ditert-butyl-4,9-dihydro-3H-carbazole (CID 70986017) is 3,6-ditert-butyl-4,9-dihydro-3H-carbazole.
What is the SMILES notation for 3,6-ditert-butyl-4,9-dihydro-3H-carbazole?
The canonical SMILES for 3,6-ditert-butyl-4,9-dihydro-3H-carbazole is CC(C)(C)c1ccc2[nH]c3c(c2c1)CC(C(C)(C)C)C=C3.
What is the InChIKey of 3,6-ditert-butyl-4,9-dihydro-3H-carbazole?
The InChIKey is JYFYTCBLMPJSQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N/c1-19(2,3)13-7-9-17-15(11-13)16-12-14(20(4,5)6)8-10-18(16)21-17/h7-11,14,21H,12H2,1-6H3.
What are the key properties of 3,6-ditert-butyl-4,9-dihydro-3H-carbazole?
3,6-ditert-butyl-4,9-dihydro-3H-carbazole has a molecular weight of 281.44 g/mol, XLogP of 5.70, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-ditert-butyl-4,9-dihydro-3H-carbazole is sourced from PubChem (CID 70986017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).