C16H17N — CID 175932907
6-tert-butyl-1,2,3,4-tetradeuterio-9H-carbazole (PubChem CID 175932907) has the molecular formula C16H17N and a molecular weight of 227.34 g/mol. Its IUPAC name is 6-tert-butyl-1,2,3,4-tetradeuterio-9H-carbazole.
| Compound Name | 6-tert-butyl-1,2,3,4-tetradeuterio-9H-carbazole |
|---|---|
| PubChem CID | 175932907 |
| Molecular Formula | C16H17N |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 6-tert-butyl-1,2,3,4-tetradeuterio-9H-carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c([nH]c3ccc(C(C)(C)C)cc32)c1[2H] |
| InChI | InChI=1S/C16H17N/c1-16(2,3)11-8-9-15-13(10-11)12-6-4-5-7-14(12)17-15/h4-10,17H,1-3H3/i4D,5D,6D,7D |
| InChIKey | TYXSZNGDCCGIBO-UGWFXTGHSA-N |
| XLogP | 4.62 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |