C32H33N — CID 67477492
3-tert-butyl-6-(2-methyl-1,1-diphenylpropyl)-9H-carbazole (PubChem CID 67477492) has the molecular formula C32H33N and a molecular weight of 431.62 g/mol. Its IUPAC name is 3-tert-butyl-6-(2-methyl-1,1-diphenylpropyl)-9H-carbazole.
| Compound Name | 3-tert-butyl-6-(2-methyl-1,1-diphenylpropyl)-9H-carbazole |
|---|---|
| PubChem CID | 67477492 |
| Molecular Formula | C32H33N |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 3-tert-butyl-6-(2-methyl-1,1-diphenylpropyl)-9H-carbazole |
| SMILES | CC(C)C(c1ccccc1)(c1ccccc1)c1ccc2[nH]c3ccc(C(C)(C)C)cc3c2c1 |
| InChI | InChI=1S/C32H33N/c1-22(2)32(23-12-8-6-9-13-23,24-14-10-7-11-15-24)26-17-19-30-28(21-26)27-20-25(31(3,4)5)16-18-29(27)33-30/h6-22,33H,1-5H3 |
| InChIKey | XBNWVXVOLGJDFC-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|