C60H72N4 — CID 139549970
2,5-dicyclohexyl-4-(3,6-ditert-butylcarbazol-9-yl)-6-(3,6-ditert-butyl-3,4-dihydrocarbazol-9-yl)benzene-1,3-dicarbonitrile (PubChem CID 139549970) has the molecular formula C60H72N4 and a molecular weight of 849.26 g/mol. Its IUPAC name is 2,5-dicyclohexyl-4-(3,6-ditert-butylcarbazol-9-yl)-6-(3,6-ditert-butyl-3,4-dihydrocarbazol-9-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 2,5-dicyclohexyl-4-(3,6-ditert-butylcarbazol-9-yl)-6-(3,6-ditert-butyl-3,4-dihydrocarbazol-9-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139549970 |
| Molecular Formula | C60H72N4 |
| Molecular Weight | 849.26 g/mol |
| Exact Mass | 848.58 |
| IUPAC Name | 2,5-dicyclohexyl-4-(3,6-ditert-butylcarbazol-9-yl)-6-(3,6-ditert-butyl-3,4-dihydrocarbazol-9-yl)benzene-1,3-dicarbonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1c(n2-c2c(C#N)c(C3CCCCC3)c(C#N)c(-n3c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)ccc43)c2C2CCCCC2)C=CC(C(C)(C)C)C1 |
| InChI | InChI=1S/C60H72N4/c1-57(2,3)39-23-27-49-43(31-39)44-32-40(58(4,5)6)24-28-50(44)63(49)55-47(35-61)53(37-19-15-13-16-20-37)48(36-62)56(54(55)38-21-17-14-18-22-38)64-51-29-25-41(59(7,8)9)33-45(51)46-34-42(60(10,11)12)26-30-52(46)64/h23-33,37-38,42H,13-22,34H2,1-12H3 |
| InChIKey | AHUWEMCNPYDRDJ-UHFFFAOYSA-N |
| XLogP | 16.69 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.26 |
| LogP ≤ 5 | 16.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |