C17H24N2 — CID 84742334
6-tert-butyl-3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 84742334) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 6-tert-butyl-3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 6-tert-butyl-3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 84742334 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 6-tert-butyl-3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1(C)Cc2c([nH]c3ccc(C(C)(C)C)cc23)CN1 |
| InChI | InChI=1S/C17H24N2/c1-16(2,3)11-6-7-14-12(8-11)13-9-17(4,5)18-10-15(13)19-14/h6-8,18-19H,9-10H2,1-5H3 |
| InChIKey | TWSPKUNQJPRWFD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|