C13H15BrN2 — CID 84743392
6-bromo-3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 84743392) has the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. Its IUPAC name is 6-bromo-3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 6-bromo-3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 84743392 |
| Molecular Formula | C13H15BrN2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 6-bromo-3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1(C)Cc2c([nH]c3ccc(Br)cc23)CN1 |
| InChI | InChI=1S/C13H15BrN2/c1-13(2)6-10-9-5-8(14)3-4-11(9)16-12(10)7-15-13/h3-5,15-16H,6-7H2,1-2H3 |
| InChIKey | GHTKIGFKFLMLDY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|