C13H16N2 — CID 84739726
3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 84739726) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 84739726 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3,3-dimethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1(C)Cc2c([nH]c3ccccc23)CN1 |
| InChI | InChI=1S/C13H16N2/c1-13(2)7-10-9-5-3-4-6-11(9)15-12(10)8-14-13/h3-6,14-15H,7-8H2,1-2H3 |
| InChIKey | RDKYENLQXHBAIM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|