C17H21N — CID 134909159
(6aR,10aS)-10a-methyl-5,6,6a,7,8,9,10,11-octahydrobenzo[b]carbazole (PubChem CID 134909159) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (6aR,10aS)-10a-methyl-5,6,6a,7,8,9,10,11-octahydrobenzo[b]carbazole.
| Compound Name | (6aR,10aS)-10a-methyl-5,6,6a,7,8,9,10,11-octahydrobenzo[b]carbazole |
|---|---|
| PubChem CID | 134909159 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (6aR,10aS)-10a-methyl-5,6,6a,7,8,9,10,11-octahydrobenzo[b]carbazole |
| SMILES | C[C@@]12CCCC[C@@H]1Cc1[nH]c3ccccc3c1C2 |
| InChI | InChI=1S/C17H21N/c1-17-9-5-4-6-12(17)10-16-14(11-17)13-7-2-3-8-15(13)18-16/h2-3,7-8,12,18H,4-6,9-11H2,1H3/t12-,17+/m1/s1 |
| InChIKey | QODXZGGCAWOAQA-PXAZEXFGSA-N |
| XLogP | 4.46 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|